2727-13-1 Usage
General Description
3-amino-6-chloropyrazine-2-carboxylic acid is a chemical compound with the molecular formula C6H5ClN3O2. It is a derivative of pyrazine and contains an amino group, a carboxylic acid group, and a chlorine atom. This chemical is commonly used in the pharmaceutical industry for the synthesis of various drugs and as a building block for organic compounds. Its properties make it a valuable intermediate in the production of pharmaceuticals, agrochemicals, and other fine chemicals. Additionally, 3-amino-6-chloropyrazine-2-carboxylic acid has potential biological activities, making it a subject of interest in medicinal chemistry research.
Check Digit Verification of cas no
The CAS Registry Mumber 2727-13-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,7,2 and 7 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 2727-13:
(6*2)+(5*7)+(4*2)+(3*7)+(2*1)+(1*3)=81
81 % 10 = 1
So 2727-13-1 is a valid CAS Registry Number.
InChI:InChI=1/C5H4ClN3O2/c6-2-1-8-4(7)3(9-2)5(10)11/h1H,(H2,7,8)(H,10,11)