2727-13-1 Usage
Uses
Used in Pharmaceutical Industry:
3-amino-6-chloropyrazine-2-carboxylic acid is used as a key intermediate for the synthesis of various drugs. Its presence of functional groups allows for easy modification and incorporation into complex molecular structures, facilitating the development of new therapeutic agents.
Used in Medicinal Chemistry Research:
3-amino-6-chloropyrazine-2-carboxylic acid is used as a subject of interest in medicinal chemistry research due to its potential biological activities. Its unique structure and functional groups make it a promising candidate for the discovery of novel compounds with therapeutic potential.
Used in Agrochemical Industry:
3-amino-6-chloropyrazine-2-carboxylic acid is used as a building block for the synthesis of agrochemicals, such as pesticides and herbicides. Its versatile chemical properties enable the development of effective compounds for agricultural applications, contributing to crop protection and yield enhancement.
Check Digit Verification of cas no
The CAS Registry Mumber 2727-13-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,7,2 and 7 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 2727-13:
(6*2)+(5*7)+(4*2)+(3*7)+(2*1)+(1*3)=81
81 % 10 = 1
So 2727-13-1 is a valid CAS Registry Number.
InChI:InChI=1/C5H4ClN3O2/c6-2-1-8-4(7)3(9-2)5(10)11/h1H,(H2,7,8)(H,10,11)
