27378-49-0

Usage

Uses

Used in Neural Cell Culture:
Poly-L-Ornithine Hydrobromide is used as a coating agent for enhancing cell adhesion in neural cell culture. It promotes the attachment and growth of neural progenitor cells and cerebral cells of mice, which is crucial for in vitro studies and research.
Used in Biomedical Research:
In the field of biomedical research, Poly-L-Ornithine Hydrobromide is used as a substrate for culturing various cell types, particularly those derived from the central nervous system. Its positive charge facilitates better cell attachment and growth, making it an essential tool for numerous research applications.
Used in Drug Delivery Systems:
Poly-L-Ornithine Hydrobromide is also employed in the development of drug delivery systems, where it can be utilized to improve the targeting and efficiency of therapeutic agents. Its cationic nature allows for better interaction with negatively charged cell membranes, potentially enhancing the delivery of drugs to specific cells or tissues.
Used in Gene Therapy:
In gene therapy, Poly-L-Ornithine Hydrobromide serves as a non-viral vector for gene delivery. Its positive charge enables it to complex with negatively charged nucleic acids, facilitating the transfer of genetic material into target cells and potentially leading to the development of novel therapeutic strategies for various diseases.
Used in Tissue Engineering:
In the field of tissue engineering, Poly-L-Ornithine Hydrobromide is used as a component in the development of scaffolds and matrices for tissue regeneration. Its ability to promote cell adhesion and growth makes it a valuable material for creating structures that can support the formation of new tissues in vivo.

Biochem/physiol Actions

Poly-L-ornithine helps to improve the penetration of substances into cells. It can induce the uptake of DNA.

InChI:InChI=1/C5H12N2O2.BrH/c6-3-1-2-4(7)5(8)9;/h4H,1-3,6-7H2,(H,8,9);1H/t4-;/m1./s1