274691-33-7 Usage
Uses
Used in Pharmaceutical Industry:
2,4-Dichloro-8-methoxy-3-phenylquinoline is used as a building block for the synthesis of various drugs due to its unique structural features and potential biological activities.
Used in Medicinal Chemistry:
2,4-Dichloro-8-methoxy-3-phenylquinoline is used as a starting material for the development of novel pharmaceuticals, leveraging its potential antimicrobial, antiviral, and antiparasitic properties.
Used in Drug Discovery:
2,4-Dichloro-8-methoxy-3-phenylquinoline is employed in drug discovery processes to explore its potential as a precursor for new therapeutic agents, given its structural attributes and possible biological effects.
Check Digit Verification of cas no
The CAS Registry Mumber 274691-33-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,7,4,6,9 and 1 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 274691-33:
(8*2)+(7*7)+(6*4)+(5*6)+(4*9)+(3*1)+(2*3)+(1*3)=167
167 % 10 = 7
So 274691-33-7 is a valid CAS Registry Number.
InChI:InChI=1/C16H11Cl2NO/c1-20-12-9-5-8-11-14(17)13(16(18)19-15(11)12)10-6-3-2-4-7-10/h2-9H,1H3
