274691-33-7 Usage
General Description
2,4-Dichloro-8-methoxy-3-phenylquinoline is a chemical compound with the molecular formula C17H12Cl2NO. It is a synthetic compound often used in the pharmaceutical industry as a building block in the synthesis of various drugs. 2,4-DICHLORO-8-METHOXY-3-PHENYLQUINOLINE has two chlorine atoms and one methoxy group attached to a quinoline ring, along with a phenyl group. It may have biological activities such as antimicrobial, antiviral, and antiparasitic properties due to its structural features. Additionally, it may have potential applications in the field of medicinal chemistry and drug discovery for the development of novel pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 274691-33-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,7,4,6,9 and 1 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 274691-33:
(8*2)+(7*7)+(6*4)+(5*6)+(4*9)+(3*1)+(2*3)+(1*3)=167
167 % 10 = 7
So 274691-33-7 is a valid CAS Registry Number.
InChI:InChI=1/C16H11Cl2NO/c1-20-12-9-5-8-11-14(17)13(16(18)19-15(11)12)10-6-3-2-4-7-10/h2-9H,1H3
