27482-50-4 Usage
Description
3-(1-Carboxyethyl)cyclo[D-Lac-L-Pro-L-Ile-N-methyl-L-Val-N-methyl-L-Ala-βAla-] is a complex cyclopeptide compound consisting of a cyclic structure formed by multiple amino acid residues, including D-Lac, L-Pro, L-Ile, N-methyl-L-Val, N-methyl-L-Ala, and βAla, along with a carboxyethyl group. This unique structure endows it with potential applications in various fields, such as pharmaceuticals, biochemistry, and drug development, due to its ability to interact with biological systems in novel ways.
Uses
Used in Pharmaceutical Industry:
3-(1-Carboxyethyl)cyclo[D-Lac-L-Pro-L-Ile-N-methyl-L-Val-N-methyl-L-Ala-βAla-] is used as a pharmaceutical agent for its potential therapeutic properties. Its unique cyclic peptide structure allows it to target specific biological pathways and interact with cellular components, offering new avenues for the treatment of various diseases.
Used in Biochemistry Research:
In the field of biochemistry, 3-(1-Carboxyethyl)cyclo[D-Lac-L-Pro-L-Ile-N-methyl-L-Val-N-methyl-L-Ala-βAla-] serves as a valuable research tool. Its distinct chemical composition and structure enable scientists to study its interactions with biomolecules, providing insights into the underlying mechanisms of various biological processes and potential applications in drug development.
Used in Drug Development:
3-(1-Carboxyethyl)cyclo[D-Lac-L-Pro-L-Ile-N-methyl-L-Val-N-methyl-L-Ala-βAla-] is utilized in drug development as a lead compound. Its unique cyclic peptide structure and the presence of a carboxyethyl group make it an interesting candidate for the design and development of new drugs with specific therapeutic targets and improved pharmacological properties. Further research and development in this area could lead to the discovery of innovative treatments for various medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 27482-50-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,7,4,8 and 2 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 27482-50:
(7*2)+(6*7)+(5*4)+(4*8)+(3*2)+(2*5)+(1*0)=124
124 % 10 = 4
So 27482-50-4 is a valid CAS Registry Number.
InChI:InChI=1/C30H49N5O9/c1-9-17(4)23-28(40)34(8)24(16(2)3)29(41)33(7)19(6)25(37)31-13-12-22(36)44-21(15-18(5)30(42)43)27(39)35-14-10-11-20(35)26(38)32-23/h16-21,23-24H,9-15H2,1-8H3,(H,31,37)(H,32,38)(H,42,43)