274927-61-6 Usage
General Description
1-Phenylmethyl-L-histidine methyl ester monohydrochloride is a chemical compound with specific features that define its composition and usage. It is derived from L-histidine, an essential amino acid that plays a crucial role in biological processes such as protein synthesis. The presence of the 1-Phenylmethyl group typically enhances the lipophilic properties of this compound. As a methyl ester, it demonstrates reactivity based on its ester group, which can participate in reactions such as hydrolysis and esterification. Its monohydrochloride form suggests that it forms a salt with hydrochloric acid, which could affect its solubility and stability. It could find applications in pharmaceutical or biochemistry research although no specific usage is widely recognized.
Check Digit Verification of cas no
The CAS Registry Mumber 274927-61-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,7,4,9,2 and 7 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 274927-61:
(8*2)+(7*7)+(6*4)+(5*9)+(4*2)+(3*7)+(2*6)+(1*1)=176
176 % 10 = 6
So 274927-61-6 is a valid CAS Registry Number.
InChI:InChI=1/C14H17N3O2.ClH/c1-19-14(18)13(15)7-12-9-17(10-16-12)8-11-5-3-2-4-6-11;/h2-6,9-10,13H,7-8,15H2,1H3;1H/t13-;/m0./s1
274927-61-6Relevant articles and documents
Imidazopyridazine compound, modified amphiphilic functional molecule and application thereof
-
Paragraph 0077-0082, (2021/05/01)
The invention provides an imidazopyridazine compound which is screened according to a DNA (Deoxyribose Nucleic Acid) encoding compound library and has better PD-L1 inhibitory activity, an amphiphilic functional molecule which can be connected with an aldo
