27580-35-4 Usage
Uses
Used in Organic Synthesis:
5-Chloro-2-methylbenzenediazonium is used as a precursor in the synthesis of various azo dyes and pigments, which are essential for coloring fabrics, plastics, and other materials. Its unique chemical structure allows for the creation of a wide range of colors through coupling reactions with other aromatic compounds.
Used in Pharmaceutical Synthesis:
In the pharmaceutical industry, 5-chloro-2-methylbenzenediazonium is utilized as a reagent for the synthesis of various organic compounds. Its ability to participate in coupling reactions and form new chemical entities makes it a valuable component in the development of novel drugs and pharmaceutical agents.
Used in Chemical Research:
5-Chloro-2-methylbenzenediazonium is also employed in chemical research as a model compound to study the properties and reactions of diazonium salts. Understanding its reactivity and behavior in various chemical environments can provide insights into the development of new synthetic methods and applications for this class of compounds.
Used in Dye and Pigment Manufacturing:
In the dye and pigment manufacturing industry, 5-chloro-2-methylbenzenediazonium is used as a key intermediate for the production of azo dyes and pigments. Its versatility in coupling reactions enables the creation of a diverse range of colorants for various applications, including textiles, plastics, and printing inks.
Used in Analytical Chemistry:
5-Chloro-2-methylbenzenediazonium can be employed in analytical chemistry as a reagent for the detection and analysis of certain compounds. Its unique chemical properties may be leveraged to develop new analytical methods or improve existing ones, enhancing the sensitivity and selectivity of chemical analyses.
Check Digit Verification of cas no
The CAS Registry Mumber 27580-35-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,7,5,8 and 0 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 27580-35:
(7*2)+(6*7)+(5*5)+(4*8)+(3*0)+(2*3)+(1*5)=124
124 % 10 = 4
So 27580-35-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H6ClN2/c1-5-2-3-6(8)4-7(5)10-9/h2-4H,1H3/q+1
