27685-95-6 Usage
Uses
Used in Pharmaceutical Industry:
4-Hydrazinothieno[3,2-c]pyridine is used as a pharmaceutical precursor for the development of new drugs, leveraging its biological activities such as anti-inflammatory, anti-cancer, and anti-microbial properties. Its potential in medicinal chemistry has led to ongoing research for creating novel pharmaceutical drugs that can address various health conditions.
Used in Organic Synthesis:
In the realm of organic synthesis, 4-hydrazinothieno[3,2-c]pyridine serves as a building block, contributing to the creation of a wide range of chemical compounds. Its structural features make it a valuable component in the synthesis of complex organic molecules, further expanding its utility in chemical research and development.
Used as a Precursor in Compound Production:
4-Hydrazinothieno[3,2-c]pyridine also functions as a precursor in the production of other compounds, indicating its versatility and importance in various chemical processes. Its role in the synthesis of diverse chemical entities underscores its multifaceted applications across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 27685-95-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,7,6,8 and 5 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 27685-95:
(7*2)+(6*7)+(5*6)+(4*8)+(3*5)+(2*9)+(1*5)=156
156 % 10 = 6
So 27685-95-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H7N3S/c8-10-7-5-2-4-11-6(5)1-3-9-7/h1-4H,8H2,(H,9,10)
27685-95-6Relevant academic research and scientific papers
PYRAZOLE DERIVATIVES AS MALT1 INHIBITORS
-
Paragraph 0978; 0979, (2018/07/05)
Disclosed are compounds, compositions and methods for treating of diseases, syndromes, conditions, and disorders that are affected by the modulation of MALT1. Such compounds are represented by Formula (I) as follows: wherein R1, R2, R3, R4, R5, R6, R5, G1, and G2 are defined herein.
