27778-30-9 Usage
General Description
2-[7-(diethylamino)-2-imino-2H-1-benzopyran-3-yl]-1,3-dimethyl-1H-benzimidazole trichlorozincate is a complex chemical compound that contains a trichlorozincate ion and a benzimidazole-based ligand. The benzimidazole ligand is a heterocyclic compound with potential biological activity and the ability to coordinate with metal ions, while the trichlorozincate ion provides the metal center for coordination. The complex may have potential applications in coordination chemistry, medicinal chemistry, or materials science due to the unique combination of the benzimidazole ligand and the zinc-containing ion. Further research is needed to fully understand the properties and potential uses of this complex chemical compound.
Check Digit Verification of cas no
The CAS Registry Mumber 27778-30-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,7,7,7 and 8 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 27778-30:
(7*2)+(6*7)+(5*7)+(4*7)+(3*8)+(2*3)+(1*0)=149
149 % 10 = 9
So 27778-30-9 is a valid CAS Registry Number.
InChI:InChI=1/C22H26N4O.3ClH.Zn/c1-5-26(6-2)16-12-11-15-13-17(21(23)27-20(15)14-16)22-24(3)18-9-7-8-10-19(18)25(22)4;;;;/h7-14,22-23H,5-6H2,1-4H3;3*1H;/q;;;;+2/p-3/rC22H26N4O.Cl3Zn/c1-5-26(6-2)16-12-11-15-13-17(21(23)27-20(15)14-16)22-24(3)18-9-7-8-10-19(18)25(22)4;1-4(2)3/h7-14,22-23H,5-6H2,1-4H3;/q;-1