27841-97-0 Usage
Uses
Used in Pharmaceutical Industry:
(Z)-2-Methyl-2-butenoic acid [(1S,2R,7aR)-hexahydro-2β-hydroxy-1H-pyrrolizin-1β-yl]methyl ester could be used as a pharmaceutical compound for its potential therapeutic properties. Pyrrolizidine alkaloids are known for their diverse biological activities, and (Z)-2-Methyl-2-butenoic acid [(1S,2R,7aR)-hexahydro-2β-hydroxy-1H-pyrrolizin-1β-yl]methyl ester may exhibit medicinal properties that could be harnessed for the development of new drugs.
Used in Chemical Research:
In the field of chemical research, (Z)-2-Methyl-2-butenoic acid [(1S,2R,7aR)-hexahydro-2β-hydroxy-1H-pyrrolizin-1β-yl]methyl ester may serve as a subject for studying the synthesis, structure, and properties of complex organic molecules. Its unique stereochemistry and the presence of a methyl ester group could provide valuable insights into the behavior of similar compounds and contribute to the advancement of organic chemistry.
References
Danilova et al.,J. Gen. Chem. USSR, 23,1417 (1953)
Danilova, Kuzovkov, ibid, 23,1597 (1953)
Danilova, Utkin, Massagetov, ibid, 25, 797 (1955)
Danilova, Utkin, ibid, 30, 345 (1960)
Culvenor, Geissman,J. Org. Chem., 26, 3045 (1961)
Check Digit Verification of cas no
The CAS Registry Mumber 27841-97-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,7,8,4 and 1 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 27841-97:
(7*2)+(6*7)+(5*8)+(4*4)+(3*1)+(2*9)+(1*7)=140
140 % 10 = 0
So 27841-97-0 is a valid CAS Registry Number.
InChI:InChI=1/C13H21NO3/c1-3-9(2)13(16)17-8-10-11-5-4-6-14(11)7-12(10)15/h3,10-12,15H,4-8H2,1-2H3/b9-3-/t10-,11-,12+/m1/s1
