28077-41-0 Usage
Description
3-(2-Methyl-1,3-thiazol-4-yl)benzoic acid is a heterocyclic chemical compound with the molecular formula C11H9NO2S. It features a benzene ring fused with a thiazole ring, creating a unique structure that is of interest in the pharmaceutical industry. The presence of a carboxylic acid functional group enhances its versatility as a building block for the synthesis of various medicinal compounds. The biological activity associated with the thiazole ring, combined with its structural attributes, positions 3-(2-Methyl-1,3-thiazol-4-yl)benzoic acid as a promising candidate for drug development and further research.
Uses
Used in Pharmaceutical Industry:
3-(2-Methyl-1,3-thiazol-4-yl)benzoic acid is used as a key intermediate in the synthesis of pharmaceuticals for its potential biological activity and structural diversity. The thiazole ring is known for its presence in various bioactive molecules, making it a valuable component in the development of new drugs.
Used in Drug Development:
In the field of drug development, 3-(2-Methyl-1,3-thiazol-4-yl)benzoic acid serves as a precursor for creating novel compounds with potential therapeutic effects. Its unique structure allows for the exploration of new chemical entities that could address unmet medical needs.
Used in Medicinal Chemistry Research:
3-(2-Methyl-1,3-thiazol-4-yl)benzoic acid is utilized in medicinal chemistry research to investigate its biological properties and to understand how its structure can be optimized for specific therapeutic targets. This research can lead to the discovery of new drugs with improved efficacy and safety profiles.
Used in Organic Synthesis:
As a versatile building block, 3-(2-Methyl-1,3-thiazol-4-yl)benzoic acid is used in organic synthesis to create a wide range of chemical compounds. Its carboxylic acid group can be modified through various chemical reactions, enabling the synthesis of diverse molecules with potential applications in different fields.
Check Digit Verification of cas no
The CAS Registry Mumber 28077-41-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,8,0,7 and 7 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 28077-41:
(7*2)+(6*8)+(5*0)+(4*7)+(3*7)+(2*4)+(1*1)=120
120 % 10 = 0
So 28077-41-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H9NO2S/c1-7-12-10(6-15-7)8-3-2-4-9(5-8)11(13)14/h2-6H,1H3,(H,13,14)
28077-41-0Relevant articles and documents
Thiazolyl benzoic acid compounds
-
, (2008/06/13)
m-(thiazol-4-yl) benzoic acids substituted in 2- and optionally 5-position of the thiazol ring by lower alkyl, phenylalkyl, phenyl, halo-phenyl, lower alkylphenyl or lower alkoxyphenyl, and on the phenyl ring of the benzoic acid moiety by halogen, hydroxyl, lower alkyl or lower alkoxy. These compounds possess fibrinolytic, platelet stickiness decreasing and antiulcer properties and have an impact on the immunological processes.
