2808-81-3 Usage
Uses
Used in Pharmaceutical Synthesis:
1-(1-phenylcyclohexyl)hexamethyleneimine is used as a building block for the synthesis of various pharmaceuticals due to its unique chemical structure and reactivity. It can be incorporated into the development of new drugs, potentially leading to novel therapeutic agents.
Used as a Ligand for Metal Ions:
In the chemical industry, 1-(1-phenylcyclohexyl)hexamethyleneimine is used as a ligand for metal ions. Its ability to form stable complexes with metals can be exploited in various applications, such as catalysis or the development of new materials with specific properties.
Used in the Chemical Industry:
1-(1-phenylcyclohexyl)hexamethyleneimine is used as a versatile intermediate in the chemical industry for the production of various organic compounds. Its unique structure allows for further functionalization and the creation of a wide range of products with different applications.
Check Digit Verification of cas no
The CAS Registry Mumber 2808-81-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,8,0 and 8 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 2808-81:
(6*2)+(5*8)+(4*0)+(3*8)+(2*8)+(1*1)=93
93 % 10 = 3
So 2808-81-3 is a valid CAS Registry Number.
InChI:InChI=1/C18H27N/c1-2-10-16-19(15-9-1)18(13-7-4-8-14-18)17-11-5-3-6-12-17/h3,5-6,11-12H,1-2,4,7-10,13-16H2
