28205-96-1 Usage
Main properties
1. Polymer compound formed from the reaction of 2-methyl-2-propenoic acid and 2-propenoic acid with sodium salt
2. High tensile strength
3. Resistance to heat and chemicals
4. Water-soluble
5. Non-toxic
Specific content
1. Used in production of adhesives, coatings, and sealants
2. Utilized in manufacture of textiles, paper products, and construction materials
3. Valuable ingredient in a wide range of manufacturing applications
4. Preferred choice for use in food packaging and medical products
Check Digit Verification of cas no
The CAS Registry Mumber 28205-96-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,8,2,0 and 5 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 28205-96:
(7*2)+(6*8)+(5*2)+(4*0)+(3*5)+(2*9)+(1*6)=111
111 % 10 = 1
So 28205-96-1 is a valid CAS Registry Number.
InChI:InChI=1/C4H6O2.C3H4O2.Na/c1-3(2)4(5)6;1-2-3(4)5;/h1H2,2H3,(H,5,6);2H,1H2,(H,4,5);/q;;+1/p-1
