2823-83-8

Usage

Uses

Used in Organic Synthesis:
N-(3,7-difluoro-9H-fluoren-2-yl)acetamide serves as a building block in organic synthesis, contributing to the creation of a diverse range of chemical compounds. Its structural attributes facilitate its integration into complex organic molecules, making it instrumental in the synthesis of new compounds with potential applications across various industries.
Used in Pharmaceutical Research:
In the pharmaceutical sector, N-(3,7-difluoro-9H-fluoren-2-yl)acetamide is utilized for the preparation of drugs and biologically active molecules. Its unique structure allows it to be a key component in the development of novel therapeutic agents, potentially leading to advancements in medicine and healthcare.
Used in Medicinal Chemistry:
N-(3,7-difluoro-9H-fluoren-2-yl)acetamide plays a significant role in medicinal chemistry, where it is employed to design and synthesize molecules with specific biological activities. Its properties make it a useful tool in drug discovery, helping researchers to create new pharmaceuticals that address various health conditions.
Used in Material Science:
N-(3,7-difluoro-9H-fluoren-2-yl)acetamide also finds applications in material science, where its unique structural features can be leveraged to develop new materials with specialized properties. These materials could have uses in a variety of applications, from electronics to advanced manufacturing processes.
Used as a Fluorescent Probe in Biological Imaging Studies:
Furthermore, N-(3,7-difluoro-9H-fluoren-2-yl)acetamide has potential as a fluorescent probe in biological imaging. Its fluorescent properties allow researchers to track and visualize biological processes at the molecular level, providing valuable insights into cellular and organismal functions.

InChI:InChI=1/C15H11F2NO/c1-8(19)18-15-6-10-4-9-5-11(16)2-3-12(9)13(10)7-14(15)17/h2-3,5-7H,4H2,1H3,(H,18,19)