2823-91-8 Usage
Uses
Used in Pharmaceutical Development:
N-(4-fluoro-9H-fluoren-2-yl)acetamide is utilized as a potential candidate in the development of pharmaceutical drugs. Its specific chemical structure, including the fluorene ring and fluoro substituent, may offer advantages in medicinal chemistry, such as enhancing drug properties or targeting specific biological pathways.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, N-(4-fluoro-9H-fluoren-2-yl)acetamide is employed as a research compound to explore its chemical and biological properties. Further studies are necessary to understand its potential interactions with biological systems and to identify its therapeutic applications.
It is crucial to handle and use N-(4-fluoro-9H-fluoren-2-yl)acetamide with care, adhering to safety protocols and guidelines, given its potential hazards and risks. Ongoing research and testing are essential to fully comprehend its properties and to harness its potential in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 2823-91-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,8,2 and 3 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 2823-91:
(6*2)+(5*8)+(4*2)+(3*3)+(2*9)+(1*1)=88
88 % 10 = 8
So 2823-91-8 is a valid CAS Registry Number.
InChI:InChI=1/C15H12FNO/c1-9(18)17-12-7-11-6-10-4-2-3-5-13(10)15(11)14(16)8-12/h2-5,7-8H,6H2,1H3,(H,17,18)
