2823-93-0 Usage
Uses
Used in Organic Synthesis:
Acetamide, N-(3-fluoro-9H-fluoren-2-yl)(9CI) is utilized as a building block in organic synthesis for the development of a diverse range of pharmaceuticals, agrochemicals, and other organic compounds. Its unique structure allows for the formation of complex molecules with potential applications in various industries.
Used in Pharmaceutical Research:
In the pharmaceutical industry, Acetamide, N-(3-fluoro-9H-fluoren-2-yl)(9CI) is employed as a key component in the synthesis of new drugs. Its incorporation into drug molecules can enhance their pharmacological properties, such as potency, selectivity, and bioavailability.
Used in Chemical Industry:
Acetamide, N-(3-fluoro-9H-fluoren-2-yl)(9CI) serves as a reagent in various organic reactions, facilitating the formation of desired products with high yields and selectivity. Its versatility makes it a valuable asset in the chemical industry for the production of a wide array of chemicals.
Used in Research Laboratories:
Acetamide, N-(3-fluoro-9H-fluoren-2-yl)(9CI) is also used in research laboratories for the development of new compounds and materials. Its unique properties and reactivity make it an attractive candidate for exploring novel chemical reactions and syntheses, ultimately contributing to the advancement of scientific knowledge and the discovery of innovative applications.
Check Digit Verification of cas no
The CAS Registry Mumber 2823-93-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,8,2 and 3 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 2823-93:
(6*2)+(5*8)+(4*2)+(3*3)+(2*9)+(1*3)=90
90 % 10 = 0
So 2823-93-0 is a valid CAS Registry Number.
InChI:InChI=1/C15H12FNO/c1-9(18)17-15-7-11-6-10-4-2-3-5-12(10)13(11)8-14(15)16/h2-5,7-8H,6H2,1H3,(H,17,18)
