28231-75-6 Usage
Uses
Used in Pharmaceutical Industry:
3-Bromo-5-(3-methylphenoxy)pyridine is used as a chemical intermediate for the synthesis of pharmaceutical compounds with potential biological activity. Its unique structure allows for the development of new molecules with therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical industry, 3-Bromo-5-(3-methylphenoxy)pyridine serves as a precursor for the development of new crop protection agents. Its chemical properties enable the creation of innovative compounds that can enhance crop yield and protect against pests and diseases.
Used in Other Chemical Industries:
3-Bromo-5-(3-methylphenoxy)pyridine may also find applications in other chemical industries for the creation of new materials and compounds. Its versatile structure allows for further functionalization and exploration of its potential in various chemical processes and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 28231-75-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,8,2,3 and 1 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 28231-75:
(7*2)+(6*8)+(5*2)+(4*3)+(3*1)+(2*7)+(1*5)=106
106 % 10 = 6
So 28231-75-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H10BrNO/c1-9-3-2-4-11(5-9)15-12-6-10(13)7-14-8-12/h2-8H,1H3
28231-75-6Relevant academic research and scientific papers
MTA-Cooperative PRMT5 Inhibitors
-
Paragraph 0265-0268, (2021/03/19)
The present invention relates to compounds that inhibit Protein Arginine N-Methyl Transferase 5 (PRMT5) activity. In particular, the present invention relates to compounds, pharmaceutical compositions and methods of use, such as methods of treating cancer using the compounds and pharmaceutical compositions of the present invention.
