28249-49-2 Usage
Uses
Used in Organic Chemistry:
3,5-Dinitro-4-methylbenzeneboronic acid is used as a reagent for the synthesis of biaryl compounds, which are important structural motifs in pharmaceuticals, agrochemicals, and materials science. Its presence in these compounds contributes to their stability and reactivity, making it a key component in the development of various organic compounds.
Used in Metal-Catalyzed Cross-Coupling Reactions:
As a ligand, 3,5-dinitro-4-methylbenzeneboronic acid is utilized in metal-catalyzed cross-coupling reactions, a class of chemical reactions that are fundamental in modern organic synthesis. Its boronic acid group forms stable complexes with metal ions, facilitating the formation of carbon-carbon and carbon-heteroatom bonds, which are crucial for the synthesis of complex organic molecules and materials.
Used in Pharmaceutical Industry:
3,5-Dinitro-4-methylbenzeneboronic acid is used as a building block in the development of pharmaceutical compounds, particularly in the synthesis of biaryl-containing drugs. Its unique structure and reactivity allow for the creation of new drug candidates with potential therapeutic applications.
Used in Materials Science:
In the field of materials science, 3,5-dinitro-4-methylbenzeneboronic acid is employed in the synthesis of advanced materials with specific properties, such as conductivity, magnetism, or optical activity. Its ability to form stable complexes with metal ions contributes to the development of materials with tailored characteristics for various applications, including sensors, catalysts, and electronic devices.
Check Digit Verification of cas no
The CAS Registry Mumber 28249-49-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,8,2,4 and 9 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 28249-49:
(7*2)+(6*8)+(5*2)+(4*4)+(3*9)+(2*4)+(1*9)=132
132 % 10 = 2
So 28249-49-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H7BN2O6/c1-4-6(9(13)14)2-5(8(11)12)3-7(4)10(15)16/h2-3,11-12H,1H3
