2826-96-2 Usage
Uses
Used in Pharmaceutical Research and Development:
(3-(2-AMINOETHYL)-1-METHYLINDOLE) 2HCL is used as a reagent in pharmaceutical research and development for its potential to modulate biological processes. (3-(2-AMINOETHYL)-1-METHYLINDOLE) 2HCL's unique structure allows it to interact with receptors or enzymes, making it a promising candidate for the development of new drugs and medicinal compounds.
Used in Organic Synthesis:
In the field of organic synthesis, (3-(2-AMINOETHYL)-1-METHYLINDOLE) 2HCL is used as a versatile building block for the synthesis of more complex organic molecules. Its unique functional groups, including the aminoethyl and methyl groups, enable it to participate in various chemical reactions, facilitating the creation of novel compounds with specific properties and applications.
Used in Drug Delivery Systems:
(3-(2-AMINOETHYL)-1-METHYLINDOLE) 2HCL can be employed in drug delivery systems to improve the solubility, stability, and bioavailability of pharmaceutical compounds. The presence of the two hydrochloride groups can enhance the compound's solubility in aqueous solutions, which is crucial for the development of effective drug formulations.
Used in Biochemical Research:
In biochemical research, (3-(2-AMINOETHYL)-1-METHYLINDOLE) 2HCL can be used as a tool compound to study the interactions between small molecules and biological targets, such as receptors or enzymes. Its unique structure and functional groups make it suitable for investigating the molecular mechanisms underlying various biological processes and diseases.
Overall, (3-(2-AMINOETHYL)-1-METHYLINDOLE) 2HCL is a valuable chemical with diverse applications in pharmaceutical research, organic synthesis, drug delivery systems, and biochemical research, owing to its unique structure and functional groups.
Check Digit Verification of cas no
The CAS Registry Mumber 2826-96-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,8,2 and 6 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 2826-96:
(6*2)+(5*8)+(4*2)+(3*6)+(2*9)+(1*6)=102
102 % 10 = 2
So 2826-96-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H14N2.2ClH/c1-13-8-9(6-7-12)10-4-2-3-5-11(10)13;;/h2-5,8H,6-7,12H2,1H3;2*1H
2826-96-2Relevant academic research and scientific papers
Liu, Zhao,Du, Qiuchen,Zhai, Hongbin,Li, Yun
, p. 7514 - 7517 (2018)
A novel relay Rh (II)/cobaloxime (III) dual catalysis strategy has been developed for the stereoselective synthesis of indolyl spiroindanones from readily accessible N-sulfonyl-1,2,3-triazoles. This binary-catalyst system enables an aza-vinyl carbene init
