2829-46-1 Usage
Uses
Used in Pharmaceutical Industry:
3-Cyano-7-hydroxy-4-methylcoumarin is used as a reagent for the stereo-specific preparation of RPand SP-O-alkyl methylphosphonyl-CHMC esters. These esters are important intermediates in the synthesis of various pharmaceutical compounds, particularly those with potential applications in the treatment of diseases such as cancer and neurological disorders. The stereo-specific nature of the preparation process ensures that the desired enantiomers are selectively produced, which is crucial for the efficacy and safety of the final drug products.
Used in Chemical Research:
In the field of chemical research, 3-Cyano-7-hydroxy-4-methylcoumarin serves as a valuable compound for studying the properties and reactivity of coumarin derivatives. Its unique structure allows researchers to explore various chemical reactions and transformations, leading to the development of new synthetic methods and the discovery of novel compounds with potential applications in various industries.
Used in Analytical Chemistry:
3-Cyano-7-hydroxy-4-methylcoumarin can also be employed as a fluorescent probe or marker in analytical chemistry. Its inherent fluorescence properties make it suitable for detecting and quantifying specific analytes in complex samples, such as those found in environmental, pharmaceutical, or biological matrices. This application can be particularly useful in the development of sensitive and selective analytical methods for monitoring the presence of target compounds in various contexts.
Check Digit Verification of cas no
The CAS Registry Mumber 2829-46-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,8,2 and 9 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 2829-46:
(6*2)+(5*8)+(4*2)+(3*9)+(2*4)+(1*6)=101
101 % 10 = 1
So 2829-46-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H7NO3/c1-6-8-3-2-7(13)4-10(8)15-11(14)9(6)5-12/h2-4,13H,1H3
