2832-87-3 Usage
General Description
ETHYL 2-(3-THIOXO-3,4-DIHYDRO-2H-1,4-BENZOTHIAZIN-2-YL)ACETATE is a chemical compound with the molecular formula C12H13NO2S2. It is a thioxo compound that belongs to the class of benzothiazines, which are organic compounds containing a 1,4-benzothiazine skeleton. ETHYL 2-(3-THIOXO-3,4-DIHYDRO-2H-1,4-BENZOTHIAZIN-2-YL)ACETATE is commonly used in organic synthesis and medicinal chemistry for its potential pharmacological properties. It is also used in the production of pharmaceutical drugs and in research and development for its potential applications in various fields.ETHYL 2-(3-THIOXO-3,4-DIHYDRO-2H-1,4-BENZOTHIAZIN-2-YL)ACETATE is known for its high purity, stability, and has a wide range of applications.
Check Digit Verification of cas no
The CAS Registry Mumber 2832-87-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,8,3 and 2 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 2832-87:
(6*2)+(5*8)+(4*3)+(3*2)+(2*8)+(1*7)=93
93 % 10 = 3
So 2832-87-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H13NO2S2/c1-2-15-11(14)7-10-12(16)13-8-5-3-4-6-9(8)17-10/h3-6,10H,2,7H2,1H3,(H,13,16)