28339-41-5 Usage
General Description
1,2,3-Metheno-1H-cycloprop[cd]indene,octahydro- is a chemical compound that contains a cyclopropane ring system and an indene group. It is a colorless liquid with a strong odor, and it is primarily used in the production of various pharmaceuticals, agrochemicals, and fine chemicals. 1,2,3-Metheno-1H-cycloprop[cd]indene,octahydro- is also known to have potential applications in the field of organic synthesis and materials science due to its unique structural properties. Additionally, 1,2,3-Metheno-1H-cycloprop[cd]indene,octahydro- is currently being studied for its potential biological activities and therapeutic applications. However, further research is needed to fully understand its properties and potential uses in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 28339-41-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,8,3,3 and 9 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 28339-41:
(7*2)+(6*8)+(5*3)+(4*3)+(3*9)+(2*4)+(1*1)=125
125 % 10 = 5
So 28339-41-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H12/c1-2-4-7-5-3(1)6-8(4)10(6)9(5)7/h3-10H,1-2H2
