28349-72-6 Usage
General Description
Acrolein/acrylic acid copolymer is a chemical compound that is created by copolymerizing acrolein and acrylic acid. This copolymer is commonly used in the production of coatings, adhesives, and various other industrial products. Its chemical structure gives it the ability to provide excellent adhesion, flexibility, and resistance to various environmental factors. Additionally, it is known for its high thermal stability and ability to withstand harsh conditions. Acrolein/acrylic acid copolymer is widely utilized in the production of paints, varnishes, and sealants due to its strong adhesive and bonding properties, making it a valuable component in numerous industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 28349-72-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,8,3,4 and 9 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 28349-72:
(7*2)+(6*8)+(5*3)+(4*4)+(3*9)+(2*7)+(1*2)=136
136 % 10 = 6
So 28349-72-6 is a valid CAS Registry Number.
InChI:InChI=1/C3H4O2.C3H4O/c1-2-3(4)5;1-2-3-4/h2H,1H2,(H,4,5);2-3H,1H2
