28382-15-2 Usage
Uses
Used in Pharmaceutical Industry:
1,2-dihydropyridazine-3,6-dione, monopotassium salt is used as a key intermediate in the synthesis of various pharmaceuticals. It plays a crucial role in the development of new drugs and the improvement of existing ones, contributing to advancements in healthcare and medicine.
Used in Agrochemical Industry:
In the agrochemical sector, 1,2-dihydropyridazine-3,6-dione, monopotassium salt is employed as a building block for the creation of agrochemicals. Its use in this industry helps in the development of pesticides, herbicides, and other agricultural products that are essential for maintaining crop health and productivity.
Used as a Reagent in Organic Synthesis:
1,2-dihydropyridazine-3,6-dione, monopotassium salt is utilized as a reagent in organic synthesis processes. It aids in the formation of complex organic molecules and contributes to the advancement of organic chemistry and its applications in various fields.
Used as a Starting Material for Organic Compounds:
This monopotassium salt serves as a starting material for the preparation of other organic compounds. Its versatility in chemical reactions makes it a valuable component in the synthesis of a wide range of organic substances, further expanding its applications across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 28382-15-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,8,3,8 and 2 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 28382-15:
(7*2)+(6*8)+(5*3)+(4*8)+(3*2)+(2*1)+(1*5)=122
122 % 10 = 2
So 28382-15-2 is a valid CAS Registry Number.
InChI:InChI=1/C4H8N4O2.K/c5-7-3(9)1-2-4(10)8-6;/h1-2H,5-6H2,(H,7,9)(H,8,10);/q;+1/b2-1-;