28393-01-3 Usage
Uses
Used in Nanocomposite Preparation:
5,7-Hexadecadiynoic acid is used as a precursor in the preparation of poly(HDDA)/zinc oxide (ZnO) nanocomposites. These nanocomposites are of interest due to their potential applications in various industries, such as electronics, coatings, and pharmaceuticals, where their unique properties can be harnessed for improved performance.
Used in Electronics Industry:
In the electronics industry, 5,7-HEXADECADIYNOIC ACID is used as a component in the development of advanced materials for electronic devices. The poly(HDDA)/ZnO nanocomposites can be utilized in the fabrication of semiconductors, transistors, and other electronic components, benefiting from the enhanced properties provided by the combination of HDDA and ZnO.
Used in Coatings Industry:
5,7-HEXADECADIYNOIC ACID is used as a key ingredient in the formulation of high-performance coatings. The poly(HDDA)/ZnO nanocomposites can improve the durability, corrosion resistance, and mechanical properties of coatings, making them suitable for various applications, such as automotive, aerospace, and industrial coatings.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 5,7-HEXADECADIYNOIC ACID is used as a building block for the synthesis of novel drug delivery systems. The poly(HDDA)/ZnO nanocomposites can be employed as carriers for drug molecules, enhancing their bioavailability, stability, and targeted delivery, ultimately leading to improved therapeutic outcomes.
Used in Research and Development:
5,7-HEXADECADIYNOIC ACID is used as a research compound for the development of new materials and applications. Its unique properties and reactivity make it an attractive candidate for further exploration in various scientific fields, including materials science, chemistry, and biotechnology.
Check Digit Verification of cas no
The CAS Registry Mumber 28393-01-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,8,3,9 and 3 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 28393-01:
(7*2)+(6*8)+(5*3)+(4*9)+(3*3)+(2*0)+(1*1)=123
123 % 10 = 3
So 28393-01-3 is a valid CAS Registry Number.
InChI:InChI=1/C16H24O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-8,13-15H2,1H3,(H,17,18)
