284492-14-4 Usage
Uses
Used in Pharmaceutical Synthesis:
FMOC-DL-3-(2-CHLOROPHENYL)-3-AMINO-PROPIONIC ACID is used as a reagent in the chemical synthesis of peptides for research and pharmaceutical applications. Its fluorogenic FMOC protecting group is particularly advantageous for solid-phase peptide synthesis, enabling the controlled and efficient assembly of peptide sequences, which is crucial for the development of new drugs and therapeutic agents.
Used in Research Applications:
In the field of research, FMOC-DL-3-(2-CHLOROPHENYL)-3-AMINO-PROPIONIC ACID is utilized as a building block for the synthesis of various peptide sequences. Its unique properties, such as the presence of the FMOC protecting group and solubility in organic solvents, make it a valuable tool for studying the structure, function, and interactions of peptides in biological systems.
Used in Peptide Drug Development:
FMOC-DL-3-(2-CHLOROPHENYL)-3-AMINO-PROPIONIC ACID is employed as a key component in the development of peptide-based drugs. Its role in solid-phase peptide synthesis allows for the creation of novel therapeutic agents with specific biological activities, potentially leading to the discovery of new treatments for various diseases and conditions.
Used in Chemical Synthesis Industry:
In the chemical synthesis industry, FMOC-DL-3-(2-CHLOROPHENYL)-3-AMINO-PROPIONIC ACID is used as a versatile reagent for the synthesis of a wide range of peptide-based compounds. Its properties, such as solubility in organic solvents and the presence of the FMOC protecting group, make it suitable for various chemical processes, including the production of pharmaceuticals, agrochemicals, and other specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 284492-14-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,8,4,4,9 and 2 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 284492-14:
(8*2)+(7*8)+(6*4)+(5*4)+(4*9)+(3*2)+(2*1)+(1*4)=164
164 % 10 = 4
So 284492-14-4 is a valid CAS Registry Number.
InChI:InChI=1/C24H20ClNO4/c25-21-12-6-5-11-19(21)22(13-23(27)28)26-24(29)30-14-20-17-9-3-1-7-15(17)16-8-2-4-10-18(16)20/h1-12,20,22H,13-14H2,(H,26,29)(H,27,28)