28593-08-0 Usage
Uses
Used in Pharmaceutical Industry:
[1,6]Naphthyridin-4-ylamine is used as a key intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of biologically active molecules. Its unique chemical structure allows it to be a part of compounds that target various diseases, including cancer and infectious diseases.
Used in Cancer Treatment Research:
In the field of oncology, [1,6]naphthyridin-4-ylamine is studied for its potential as a therapeutic agent. It is explored for its capacity to interact with cellular mechanisms, which may lead to the inhibition of cancer cell growth or the enhancement of the effectiveness of existing cancer treatments.
Used in Infectious Disease Treatment Research:
Similarly, [1,6]naphthyridin-4-ylamine is also considered for its potential role in treating infectious diseases. Its chemical properties may enable the creation of compounds that can target pathogens or modulate the immune response, offering new avenues for treatment.
Check Digit Verification of cas no
The CAS Registry Mumber 28593-08-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,8,5,9 and 3 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 28593-08:
(7*2)+(6*8)+(5*5)+(4*9)+(3*3)+(2*0)+(1*8)=140
140 % 10 = 0
So 28593-08-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H7N3/c9-7-1-4-11-8-2-3-10-5-6(7)8/h1-5H,(H2,9,11)
