28664-92-8 Usage
Description
3-(phenoxymethyl)-2-benzofurancarboxylic acid is an organic compound with a chemical formula C15H12O4. It is a derivative of 2-benzofurancarboxylic acid, containing a phenoxymethyl group attached to the third position of the benzofuran ring. 3-(phenoxymethyl)-2-benzofurancarboxylic acid has potential pharmaceutical applications and is being studied for its antifungal and anti-inflammatory properties. Its structure and properties make it a promising candidate for the development of new drugs, and research into its biological effects is ongoing.
Uses
Used in Pharmaceutical Industry:
3-(phenoxymethyl)-2-benzofurancarboxylic acid is used as a pharmaceutical agent for its potential antifungal and anti-inflammatory properties. Its unique structure allows it to target specific biological pathways, making it a promising candidate for the development of new drugs to treat various conditions.
Used in Drug Development:
3-(phenoxymethyl)-2-benzofurancarboxylic acid is used as a starting material in the synthesis of new drugs. Its chemical properties and potential therapeutic effects make it a valuable compound for researchers to explore and develop novel pharmaceuticals to address unmet medical needs.
Used in Research:
3-(phenoxymethyl)-2-benzofurancarboxylic acid is used as a research tool to study its biological effects and potential applications. Ongoing research is focused on understanding its mechanism of action, as well as identifying new uses and optimizing its therapeutic potential.
Check Digit Verification of cas no
The CAS Registry Mumber 28664-92-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,8,6,6 and 4 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 28664-92:
(7*2)+(6*8)+(5*6)+(4*6)+(3*4)+(2*9)+(1*2)=148
148 % 10 = 8
So 28664-92-8 is a valid CAS Registry Number.
InChI:InChI=1/C16H12O4/c17-16(18)15-13(10-19-11-6-2-1-3-7-11)12-8-4-5-9-14(12)20-15/h1-9H,10H2,(H,17,18)/p-1