28666-87-7 Usage
Perchlorate salt
The compound is a perchlorate salt, which means it contains perchlorate anions (ClO4-) as its counterion.
Synthetic chemical
2,4,9-trimethyl-7-thia-5-aza-1-azoniabicyclo[4.3.0]nona-1,3,5,8-tetraene perchlorate is likely synthesized in a laboratory, rather than occurring naturally.
Check Digit Verification of cas no
The CAS Registry Mumber 28666-87-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,8,6,6 and 6 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 28666-87:
(7*2)+(6*8)+(5*6)+(4*6)+(3*6)+(2*8)+(1*7)=157
157 % 10 = 7
So 28666-87-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H11N2S.ClHO4/c1-6-4-7(2)11-8(3)5-12-9(11)10-6;2-1(3,4)5/h4-5H,1-3H3;(H,2,3,4,5)/q+1;/p-1
