28691-49-8 Usage
Uses
Used in Chemical Synthesis:
6-Chlorobenzo[d]isoxazole-3-carboxylic acid is used as a chemical intermediate for the synthesis of various complex chemical compounds. Its unique structure allows it to be a key component in the creation of new molecules with potential applications in various industries.
Used in Pharmaceutical Industry:
6-Chlorobenzo[d]isoxazole-3-carboxylic acid is used as a building block in the development of new pharmaceutical compounds. Its carboxylic acid group and benzene ring provide a versatile structure that can be modified to create drugs with specific therapeutic properties.
Used in Industrial Processes:
6-Chlorobenzo[d]isoxazole-3-carboxylic acid is used as a raw material in the production of certain industrial chemicals. Its reactivity and structural properties make it a valuable component in the manufacturing of various products, such as dyes, plastics, and coatings.
Used in Research and Development:
6-Chlorobenzo[d]isoxazole-3-carboxylic acid is used as a research compound for studying its chemical properties and potential applications. Scientists and researchers utilize 6-Chlorobenzo[d]isoxazole-3-carboxylic acid to explore new reactions, syntheses, and applications in various fields, including materials science and biotechnology.
Check Digit Verification of cas no
The CAS Registry Mumber 28691-49-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,8,6,9 and 1 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 28691-49:
(7*2)+(6*8)+(5*6)+(4*9)+(3*1)+(2*4)+(1*9)=148
148 % 10 = 8
So 28691-49-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H4ClNO3/c9-4-1-2-5-6(3-4)13-10-7(5)8(11)12/h1-3H,(H,11,12)
