28751-69-1 Usage
Description
1H-Indazole-3-carbothioamide is a chemical compound with the molecular formula C8H8N2S. It is an indazole derivative that contains a thiocarbonyl group. 1H-Indazole-3-carbothioamide has potential applications in medicinal chemistry and drug development due to its molecular structure and potential reactivity.
Uses
Used in Pharmaceutical Industry:
1H-Indazole-3-carbothioamide is used as a building block for the synthesis of various pharmaceutical compounds. Its unique molecular structure and reactivity make it a potentially useful tool for the development of new drugs.
Used in Drug Development:
1H-Indazole-3-carbothioamide is used as a potential lead compound for the development of new drugs with therapeutic applications. Its properties and reactivity have shown promise in the study of its potential biological activities, making it a valuable candidate for further research and development in the field of medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 28751-69-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,8,7,5 and 1 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 28751-69:
(7*2)+(6*8)+(5*7)+(4*5)+(3*1)+(2*6)+(1*9)=141
141 % 10 = 1
So 28751-69-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H7N3S/c9-8(12)7-5-3-1-2-4-6(5)10-11-7/h1-4H,(H2,9,12)(H,10,11)
28751-69-1Relevant articles and documents
Gyrase inhibitors
-
Page/Page column 74, (2008/06/13)
Compounds comprising an indazolyl group and a thiazolyl group, preferably 7-substituted 3-(thiazol-2-yl)-1H-indazole compounds in which the indazolyl group and a thiazolyl group are each independently optionally substituted, are useful for the treatment or prophylaxis of bacterial infections in mammals. The compounds are believed to function by inhibiting gyrase B.