28777-98-2 Usage
General Description
Issoctadecenylsuccinic anhydride is a chemical compound that belongs to the class of succinic anhydrides, which are widely used as intermediates in the chemical industry. ISOOCTADECENYLSUCCINIC ANHYDRIDE is derived from the reaction between isooctadecenyl alcohol and maleic anhydride. It is commonly used as a coupling agent and surface modifier in the production of various materials, such as polymers, adhesives, and coatings. Issoctadecenylsuccinic anhydride is known for its ability to improve the adhesion, compatibility, and performance of different materials, making it a valuable component in the formulation of various industrial products. Additionally, it is also used as a corrosion inhibitor in lubricants and metalworking fluids due to its ability to form a protective film on metal surfaces.
Check Digit Verification of cas no
The CAS Registry Mumber 28777-98-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,8,7,7 and 7 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 28777-98:
(7*2)+(6*8)+(5*7)+(4*7)+(3*7)+(2*9)+(1*8)=172
172 % 10 = 2
So 28777-98-2 is a valid CAS Registry Number.
InChI:InChI=1/C22H38O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-19-21(23)25-22(20)24/h17-18,20H,2-16,19H2,1H3/b18-17+