287928-09-0 Usage
General Description
3-[(4-chlorobenzyl)oxy]-2-methylpyridin-4-ol is a chemical compound with the molecular formula C14H12ClNO2. It is a pyridinol derivative that contains a 4-chlorobenzyl group and a methyl group. 3-[(4-chlorobenzyl)oxy]-2-methylpyridin-4-ol has potential pharmaceutical applications due to its properties. Its structure suggests that it may have biological activity, particularly in the central nervous system, and it may also have potential as a drug or lead compound for medicinal chemistry research. Further investigation into the pharmacological and toxicological properties of 3-[(4-chlorobenzyl)oxy]-2-methylpyridin-4-ol is warranted to fully understand its potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 287928-09-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,8,7,9,2 and 8 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 287928-09:
(8*2)+(7*8)+(6*7)+(5*9)+(4*2)+(3*8)+(2*0)+(1*9)=200
200 % 10 = 0
So 287928-09-0 is a valid CAS Registry Number.
InChI:InChI=1/C13H12ClNO2/c1-9-13(12(16)6-7-15-9)17-8-10-2-4-11(14)5-3-10/h2-7H,8H2,1H3,(H,15,16)
