288386-15-2 Usage
Description
1H-Indol-5-ol, 6-fluoro(9CI) is a chemical compound with the molecular formula C8H6FNO. It is a derivative of indole, a heterocyclic aromatic organic compound, featuring a fluorine atom attached at the sixth position. 1H-Indol-5-ol, 6-fluoro(9CI) is known for its unique structure and properties, making it a valuable building block in the development of new drugs and therapeutic agents.
Uses
Used in Pharmaceutical Industry:
1H-Indol-5-ol, 6-fluoro(9CI) is used as a key intermediate in the synthesis of various drugs and bioactive molecules. Its unique structure and properties contribute to the development of new therapeutic agents with potential applications in the treatment of various diseases.
1. As a Building Block for Drug Development:
1H-Indol-5-ol, 6-fluoro(9CI) is utilized as a building block for the creation of new drugs due to its interesting biological activities and potential applications in treating various diseases. Its unique structure allows for the design and synthesis of novel compounds with improved pharmacological properties.
2. For the Synthesis of Bioactive Molecules:
1H-Indol-5-ol, 6-fluoro(9CI) is also used in the synthesis of bioactive molecules, which can exhibit a range of biological activities, such as anti-inflammatory, anti-cancer, or neuroprotective effects. The incorporation of the fluorine atom at the sixth position may enhance the bioactivity and selectivity of the resulting molecules.
3. In Drug Discovery Research:
1H-Indol-5-ol, 6-fluoro(9CI) is employed in drug discovery research to identify and optimize potential drug candidates. Its unique structure and properties make it an attractive starting point for the development of new therapeutic agents with improved efficacy and safety profiles.
Check Digit Verification of cas no
The CAS Registry Mumber 288386-15-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,8,8,3,8 and 6 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 288386-15:
(8*2)+(7*8)+(6*8)+(5*3)+(4*8)+(3*6)+(2*1)+(1*5)=192
192 % 10 = 2
So 288386-15-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H6FNO/c9-6-4-7-5(1-2-10-7)3-8(6)11/h1-4,10-11H
288386-15-2Relevant articles and documents
Pyridyloxyindoles Inhibitors of VEGF-R2 and Use Thereof for Treatment of Disease
-
Page/Page column 52, (2010/06/22)
The invention relates to novel organic compounds of formula (I), and their use in the treatment of the animal or human body, to pharmaceutical compositions comprising a compound of formula I and to the use of a compound of formula I for the preparation of pharmaceutical compositions for use in the treatment of protein kinase dependent diseases, especially of proliferative diseases, such as in the treatment of tumour diseases and ocular neovascular diseases.
