28879-19-8 Usage
Description
Trifluoro(2,4-xylylamine)boron is a boron compound that is widely utilized in organic chemistry research and industry. It features a boron atom connected to a trifluoro(2,4-xylylamine) ligand, which is derived from the xylylamine molecule and includes three fluorine atoms. trifluoro(2,4-xylylamine)boron is recognized for its capacity to function as a Lewis acid catalyst in a variety of chemical reactions, especially in the creation of carbon-carbon and carbon-heteroatom bonds. Its distinctive structure and reactivity render it an invaluable asset in the development of innovative materials and compounds with promising industrial applications.
Uses
Used in Organic Chemistry Research:
Trifluoro(2,4-xylylamine)boron is employed as a Lewis acid catalyst for facilitating various chemical reactions, particularly those involving the formation of carbon-carbon and carbon-heteroatom bonds. Its use enhances the efficiency and selectivity of these reactions, making it a crucial component in organic synthesis.
Used in Pharmaceutical Synthesis:
In the pharmaceutical industry, trifluoro(2,4-xylylamine)boron is used as a reagent in the synthesis of various pharmaceuticals. Its unique catalytic properties contribute to the production of complex organic compounds that are essential in the development of new drugs.
Used in Agrochemical Production:
Trifluoro(2,4-xylylamine)boron also finds application in the agrochemical sector, where it is utilized in the synthesis of compounds used in the development of pesticides and other agricultural chemicals. Its role in facilitating key chemical reactions aids in the production of effective and targeted agrochemicals.
Used in the Development of New Materials:
trifluoro(2,4-xylylamine)boron's unique structure and reactivity make it a valuable tool in the creation of new materials with potential applications across various industries. Its use in material science can lead to the discovery of innovative materials with enhanced properties.
Check Digit Verification of cas no
The CAS Registry Mumber 28879-19-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,8,8,7 and 9 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 28879-19:
(7*2)+(6*8)+(5*8)+(4*7)+(3*9)+(2*1)+(1*9)=168
168 % 10 = 8
So 28879-19-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H11N.BF3/c1-6-3-4-8(9)7(2)5-6;2-1(3)4/h3-5H,9H2,1-2H3;
