289039-34-5 Usage
Uses
Used in Chemical Research and Development:
5-Chloro-2-Fluorophenetole is utilized as a key intermediate in the synthesis of more complex molecules, particularly in the field of organic chemistry. Its unique molecular structure, which includes both chlorine and fluorine atoms, contributes to its versatility in chemical reactions and its potential for creating novel compounds with specific properties.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 5-Chloro-2-Fluorophenetole may be employed as a building block for the development of new drugs. Its ability to participate in various chemical reactions allows for the creation of molecules with potential therapeutic applications, including those targeting specific diseases or conditions.
Used in Material Science:
5-Chloro-2-Fluorophenetole can also be used in material science for the development of new materials with unique properties. Its incorporation into polymers or other materials may result in enhanced characteristics such as improved stability, reactivity, or selectivity in certain applications.
Used in Agrochemical Industry:
In the agrochemical industry, 5-Chloro-2-Fluorophenetole may serve as a precursor for the synthesis of pesticides or other agricultural chemicals. Its chemical properties could be harnessed to create compounds that effectively control pests or enhance crop yields.
Used in Environmental Applications:
5-Chloro-2-Fluorophenetole could potentially be applied in environmental remediation processes. Its chemical properties may allow it to interact with pollutants or contaminants, facilitating their removal or transformation into less harmful substances.
Check Digit Verification of cas no
The CAS Registry Mumber 289039-34-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,8,9,0,3 and 9 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 289039-34:
(8*2)+(7*8)+(6*9)+(5*0)+(4*3)+(3*9)+(2*3)+(1*4)=175
175 % 10 = 5
So 289039-34-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H8ClFO/c1-2-11-8-5-6(9)3-4-7(8)10/h3-5H,2H2,1H3
