289039-35-6 Usage
General Description
2-Chloro-5-Fluorophenetole is a chemical compound that belongs to the group of organic compounds known as phenetoles. These are compounds containing a phenetole moiety, which consists of a phenyl group attached to a methoxy group. This specific compound is distinguished by the presence of chlorine and fluorine atoms substituted at the 2nd and 5th positions respectively on the phenyl ring. Applications of 2-Chloro-5-Fluorophenetole are mainly found in the chemical and pharmaceutical industries, where it may contribute to the synthesis of more complex compounds due to its reactive nature. Because it is a specialized chemical substance, it is primarily handled and used by chemical professionals and researchers. It is advisable to handle this chemical carefully due to potential safety and health risks, and environmental impacts.
Check Digit Verification of cas no
The CAS Registry Mumber 289039-35-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,8,9,0,3 and 9 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 289039-35:
(8*2)+(7*8)+(6*9)+(5*0)+(4*3)+(3*9)+(2*3)+(1*5)=176
176 % 10 = 6
So 289039-35-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H8ClFO/c1-2-11-8-5-6(10)3-4-7(8)9/h3-5H,2H2,1H3
