289039-48-1 Usage
Description
4,5-DIBROMO-2-FLUOROBENZOIC ACID is an organic compound derived from 4,5-Dibromo-2-fluorotoluene, characterized by its unique chemical structure featuring two bromine atoms and a fluorine atom attached to a benzoic acid backbone. It is utilized in various applications across different industries due to its distinct properties.
Uses
Used in Chemical Synthesis:
4,5-DIBROMO-2-FLUOROBENZOIC ACID is used as an intermediate in the synthesis of various organic compounds. Its unique structure allows it to serve as a reactant or reagent in the production of a range of chemical products.
Used in Pharmaceutical Industry:
4,5-DIBROMO-2-FLUOROBENZOIC ACID is used as an analytical standard in the pharmaceutical industry. Its distinct chemical properties make it a valuable reference compound for quality control and analytical testing, ensuring the purity and efficacy of pharmaceutical products.
Used in Research and Development:
In the field of research and development, 4,5-DIBROMO-2-FLUOROBENZOIC ACID is employed as a key compound for studying its potential applications in various scientific domains. Its unique structure and properties make it an interesting subject for further exploration and innovation.
Used in Material Science:
4,5-DIBROMO-2-FLUOROBENZOIC ACID may also find applications in material science, where its unique chemical structure could be leveraged to develop new materials with specific properties, such as enhanced stability or reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 289039-48-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,8,9,0,3 and 9 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 289039-48:
(8*2)+(7*8)+(6*9)+(5*0)+(4*3)+(3*9)+(2*4)+(1*8)=181
181 % 10 = 1
So 289039-48-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H3Br2FO2/c8-4-1-3(7(11)12)6(10)2-5(4)9/h1-2H,(H,11,12)
