289039-84-5 Usage
Uses
Used in Scientific Research:
METHYL 2-AMINO-5-CHLORO-3-IODOBENZOATE is used as a research chemical for various scientific applications, particularly in the field of organic chemistry. It serves as a key intermediate in the synthesis of more complex molecules and compounds, contributing to the advancement of chemical research and development.
Used in Organic Chemistry Synthesis:
In the field of organic chemistry, METHYL 2-AMINO-5-CHLORO-3-IODOBENZOATE is used as a synthetic building block. Its unique structure allows for the creation of a wide range of chemical products, making it a valuable asset in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Laboratory Environments:
Due to its reactive properties, METHYL 2-AMINO-5-CHLORO-3-IODOBENZOATE is primarily used in controlled laboratory settings. It is synthesized and handled with caution to ensure safety and to prevent unintended reactions, making it an essential component in the development of new chemical processes and products.
Check Digit Verification of cas no
The CAS Registry Mumber 289039-84-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,8,9,0,3 and 9 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 289039-84:
(8*2)+(7*8)+(6*9)+(5*0)+(4*3)+(3*9)+(2*8)+(1*4)=185
185 % 10 = 5
So 289039-84-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H7ClINO2/c1-13-8(12)5-2-4(9)3-6(10)7(5)11/h2-3H,11H2,1H3
