28932-22-1 Usage
Uses
Used in Textile Industry:
Dihydro-1,4,5,8-tetrahydroxyanthraquinone is used as a dye in the textile industry for its ability to impart color to fabrics. Its chemical properties allow it to bind effectively with textile fibers, providing vibrant and long-lasting coloration.
Used as a pH Indicator:
Dihydro-1,4,5,8-tetrahydroxyanthraquinone is used as a pH indicator due to its ability to change color in response to different pH levels. This property makes it useful in various chemical and biological applications where pH monitoring is required.
Used in Pharmaceutical Synthesis:
Dihydro-1,4,5,8-tetrahydroxyanthraquinone is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique chemical structure allows it to be modified and incorporated into a wide range of drug molecules, contributing to the development of new therapeutic agents.
Used in Medical Research:
Dihydro-1,4,5,8-tetrahydroxyanthraquinone is used in medical research for its potential antioxidant and anti-inflammatory properties. These properties make it a promising candidate for the development of treatments for various diseases and conditions, including cancer.
Used in Anticancer Applications:
Dihydro-1,4,5,8-tetrahydroxyanthraquinone is being studied for its anticancer effects and potential use in cancer therapy. Its ability to exhibit cytotoxicity against cancer cells and modulate various signaling pathways involved in tumor growth and progression makes it a valuable compound in the search for novel cancer treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 28932-22-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,8,9,3 and 2 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 28932-22:
(7*2)+(6*8)+(5*9)+(4*3)+(3*2)+(2*2)+(1*2)=131
131 % 10 = 1
So 28932-22-1 is a valid CAS Registry Number.
InChI:InChI=1/C14H10O6/c15-5-1-2-6(16)10-9(5)13(19)11-7(17)3-4-8(18)12(11)14(10)20/h1-4,9-10,15-18H
