2896-97-1 Usage
Uses
Used in Pharmaceutical Industry:
2-cyclopropyl formamidoimidazole-5-chloro benzophenone is utilized as a key component in the development of new drugs. Its cyclopropyl group imparts specific chemical characteristics that can be harnessed to create innovative pharmaceutical agents.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 2-cyclopropyl formamidoimidazole-5-chloro benzophenone serves as a versatile building block for the synthesis of novel molecules. The presence of the chloro-substituted benzophenone group enhances the compound's reactivity, facilitating the creation of diverse therapeutic agents.
Used in Drug Discovery:
2-cyclopropyl formamidoimidazole-5-chloro benzophenone is employed in drug discovery processes to identify potential candidates for various therapeutic applications. Its unique structure allows for the exploration of new chemical spaces and the development of compounds with improved pharmacological profiles.
Used in Industrial Applications:
Beyond the pharmaceutical sector, 2-cyclopropyl formamidoimidazole-5-chloro benzophenone also finds use in other industries. Its unique chemical properties make it suitable for a range of applications, including the development of new materials and chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 2896-97-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,8,9 and 6 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 2896-97:
(6*2)+(5*8)+(4*9)+(3*6)+(2*9)+(1*7)=131
131 % 10 = 1
So 2896-97-1 is a valid CAS Registry Number.
InChI:InChI=1/C17H14ClNO2/c18-13-8-9-15(19-17(21)12-6-7-12)14(10-13)16(20)11-4-2-1-3-5-11/h1-5,8-10,12H,6-7H2,(H,19,21)
