289677-06-1 Usage
General Description
L-N-(4'-N-CBZ-PIPERIDINO)PROLINE is a chemical compound characterized by the incorporation of a piperidine ring and a proline residue. It is commonly used in peptide synthesis and drug development, particularly in the creation of pharmaceutical compounds. The compound is also known for its potential use as a building block for various bioactive peptides, due to its ability to modulate biological functions. Additionally, L-N-(4'-N-CBZ-PIPERIDINO)PROLINE has shown promise in biomedical applications as an inhibitor for certain enzymes and as a ligand for specific receptors, indicating its potential pharmacological significance. Overall, the compound represents an important tool in the field of chemical biology and pharmaceutical research.
Check Digit Verification of cas no
The CAS Registry Mumber 289677-06-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,8,9,6,7 and 7 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 289677-06:
(8*2)+(7*8)+(6*9)+(5*6)+(4*7)+(3*7)+(2*0)+(1*6)=211
211 % 10 = 1
So 289677-06-1 is a valid CAS Registry Number.
InChI:InChI=1/C18H24N2O4/c21-17(22)16-7-4-10-20(16)15-8-11-19(12-9-15)18(23)24-13-14-5-2-1-3-6-14/h1-3,5-6,15-16H,4,7-13H2,(H,21,22)/t16-/m0/s1