289677-12-9 Usage
Description
3',5'-DIFLUOROBENZENE ACETYL PIPERIDINE THIOAMIDE is a chemical compound characterized by a benzene ring with fluorine atoms at the 3' and 5' positions, an acetyl group, a piperidine ring, and a thioamide group. 3',5'-DIFLUOROBENZENE ACETYL PIPERIDINE THIOAMIDE is known for its high electronegativity due to the presence of fluorine atoms and unique chemical properties conferred by the thioamide group. It is a versatile molecule with potential applications in the development of pharmaceuticals and agrochemicals.
Uses
Used in Organic Chemistry Research:
3',5'-DIFLUOROBENZENE ACETYL PIPERIDINE THIOAMIDE is used as a research compound in organic chemistry for studying its chemical properties and reactions. Its unique structure allows chemists to explore various synthetic pathways and mechanisms.
Used in Pharmaceutical Industry:
3',5'-DIFLUOROBENZENE ACETYL PIPERIDINE THIOAMIDE is used as a building block in the synthesis of various pharmaceuticals. Its electronegative fluorine atoms and thioamide group can influence the biological activity and pharmacokinetics of the resulting drug molecules, potentially leading to the development of new therapeutic agents.
Used in Agrochemical Industry:
3',5'-DIFLUOROBENZENE ACETYL PIPERIDINE THIOAMIDE is used as a precursor in the synthesis of agrochemicals, such as pesticides and herbicides. Its unique chemical properties can contribute to the effectiveness and selectivity of these compounds in controlling pests and weeds in agricultural settings.
Check Digit Verification of cas no
The CAS Registry Mumber 289677-12-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,8,9,6,7 and 7 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 289677-12:
(8*2)+(7*8)+(6*9)+(5*6)+(4*7)+(3*7)+(2*1)+(1*2)=209
209 % 10 = 9
So 289677-12-9 is a valid CAS Registry Number.
InChI:InChI=1/C13H15F2NS/c14-11-6-10(7-12(15)9-11)8-13(17)16-4-2-1-3-5-16/h6-7,9H,1-5,8H2