28968-09-4 Usage
Uses
Used in Pharmaceutical Industry:
(1S)-6-chloro-5-cyclohexyl-2,3-dihydro-1H-indene-1-carboxylic acid is used as a building block for the synthesis of pharmaceutical compounds due to its unique structural features and reactivity. Its cyclohexyl and chloro substituents contribute to the development of new drugs with potential therapeutic applications.
Used in Drug Development:
As a chemical intermediate, (1S)-6-chloro-5-cyclohexyl-2,3-dihydro-1H-indene-1-carboxylic acid plays a crucial role in drug development. Its properties allow for the creation of novel molecules with potential medicinal uses, contributing to the advancement of treatments for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 28968-09-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,8,9,6 and 8 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 28968-09:
(7*2)+(6*8)+(5*9)+(4*6)+(3*8)+(2*0)+(1*9)=164
164 % 10 = 4
So 28968-09-4 is a valid CAS Registry Number.
InChI:InChI=1/C16H19ClO2/c17-15-9-13-11(6-7-12(13)16(18)19)8-14(15)10-4-2-1-3-5-10/h8-10,12H,1-7H2,(H,18,19)/t12-/m0/s1
