29001-27-2 Usage
Description
6-amino-7-methoxy-4-methyl-chromen-2-one is an organic compound with a unique chemical structure that features a chromenone core with a methyl group at the 4-position, a methoxy group at the 7-position, and an amino group at the 6-position. 6-amino-7-methoxy-4-methyl-chromen-2-one has attracted interest due to its potential applications in various fields, particularly in the synthesis of other compounds.
Uses
Used in Pharmaceutical Industry:
6-amino-7-methoxy-4-methyl-chromen-2-one is used as a reactant for the synthesis of pyranoacridones, which are a class of compounds with significant biological activities. These pyranoacridones have been found to possess anticancer properties, making them valuable in the development of new therapeutic agents for the treatment of various types of cancer.
Used in Chemical Synthesis:
In the field of chemical synthesis, 6-amino-7-methoxy-4-methyl-chromen-2-one serves as an important building block for the creation of more complex molecules with potential applications in various industries, such as pharmaceuticals, agrochemicals, and materials science. Its unique structure allows for further functionalization and modification, enabling the development of novel compounds with tailored properties and functions.
Check Digit Verification of cas no
The CAS Registry Mumber 29001-27-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,0,0 and 1 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 29001-27:
(7*2)+(6*9)+(5*0)+(4*0)+(3*1)+(2*2)+(1*7)=82
82 % 10 = 2
So 29001-27-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H11NO3/c1-6-3-11(13)15-9-5-10(14-2)8(12)4-7(6)9/h3-5H,12H2,1-2H3
