2906-84-5 Usage
Uses
1. Used in Pharmaceutical Applications:
1-(2-(1,4-Benzodioxan-5-yloxy)ethyl)-1-methylhexahydro-1H-azepinium iodide is used as an active pharmaceutical ingredient for its potential therapeutic effects, leveraging its unique molecular structure to target specific biological pathways or receptors.
2. Used in Organic Synthesis:
1-(2-(1,4-Benzodioxan-5-yloxy)ethyl)-1-methylhexahydro-1H-azepinium io dide serves as a key intermediate or building block in the synthesis of other complex organic molecules, contributing to the development of novel chemical entities with diverse applications.
3. Used in Research:
1-(2-(1,4-Benzodioxan-5-yloxy)ethyl)-1-methylhexahydro-1H-azepinium iodide is utilized in research settings to study its chemical properties, reactivity, and potential interactions with biological systems, furthering the understanding of its possible applications and effects.
4. Used in Material Science:
1-(2-(1,4-Benzodioxan-5-yloxy)ethyl)-1-methylhexahydro-1H-azepinium io dide may find applications in the development of new materials, such as polymers or other advanced materials, due to its unique structural features and potential for modification.
5. Used in Chemical Analysis:
1-(2-(1,4-Benzodioxan-5-yloxy)ethyl)-1-methylhexahydro-1H-azepinium iodide can be employed as a reference compound or standard in analytical chemistry, aiding in the identification and quantification of similar compounds in various samples.
Check Digit Verification of cas no
The CAS Registry Mumber 2906-84-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,9,0 and 6 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 2906-84:
(6*2)+(5*9)+(4*0)+(3*6)+(2*8)+(1*4)=95
95 % 10 = 5
So 2906-84-5 is a valid CAS Registry Number.
InChI:InChI=1/C17H26NO3.HI/c1-18(9-4-2-3-5-10-18)11-12-19-15-7-6-8-16-17(15)21-14-13-20-16;/h6-8H,2-5,9-14H2,1H3;1H/q+1;/p-1
