29112-90-1 Usage
Uses
Used in Pharmaceutical Synthesis:
2',5'-Difluoropropiophenone is employed as a key intermediate in the synthesis of various pharmaceuticals. Its unique chemical structure allows for the development of new drugs with improved properties, such as enhanced efficacy and selectivity.
Used in Agrochemical Production:
2',5'-DIFLUOROPROPIOPHENONE also finds application in the production of agrochemicals, contributing to the development of more effective and targeted pesticides and other agricultural chemicals.
Used in Flavor and Fragrance Industry:
2',5'-Difluoropropiophenone is utilized in the creation of flavor and fragrance compounds, capitalizing on its strong, sweet, and floral scent to enhance the sensory experience of various consumer products, such as perfumes, cosmetics, and food products.
Check Digit Verification of cas no
The CAS Registry Mumber 29112-90-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,1,1 and 2 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 29112-90:
(7*2)+(6*9)+(5*1)+(4*1)+(3*2)+(2*9)+(1*0)=101
101 % 10 = 1
So 29112-90-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H8F2O/c1-2-9(12)7-5-6(10)3-4-8(7)11/h3-5H,2H2,1H3
