29116-98-1 Usage
General Description
Sorbitan, di-9-octadecenoate, (Z,Z)- is a chemical compound commonly used as an emulsifier in various industries, including food, pharmaceuticals, and cosmetics. It is derived from sorbitol and oleic acid and is known for its ability to stabilize and mix oil and water-based ingredients. Sorbitan, di-9-octadecenoate, (Z,Z)- is commonly found in products such as creams, lotions, and certain food items to improve their consistency and texture. It is considered safe for human consumption and is regulated by various health and safety organizations. Additionally, it is known for its non-toxic and biodegradable properties, making it a popular choice for use in consumer products.
Check Digit Verification of cas no
The CAS Registry Mumber 29116-98-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,1,1 and 6 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 29116-98:
(7*2)+(6*9)+(5*1)+(4*1)+(3*6)+(2*9)+(1*8)=121
121 % 10 = 1
So 29116-98-1 is a valid CAS Registry Number.
InChI:InChI=1/C42H76O7/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-39(43)47-35-37-41(45)42(46)38(49-37)36-48-40(44)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,37-38,41-42,45-46H,3-16,21-36H2,1-2H3