29133-52-6 Usage
General Description
1-Methoxyberberium is a chemical compound that belongs to the berberine alkaloid group and is derived from plants such as Barberry and Goldenseal. It is known for its various medicinal properties, including its antimicrobial, antioxidant, and anti-inflammatory effects. 1-Methoxyberberium has been widely studied for its potential use in the treatment of various health conditions, including bacterial infections, gastrointestinal disorders, and inflammation-related diseases. Its ability to inhibit the growth of bacteria and fungi, as well as its anti-inflammatory properties, make it a promising candidate for the development of new pharmaceutical treatments. Additionally, 1-Methoxyberberium has been investigated for its potential use in skincare products due to its antioxidant properties, which can help protect the skin from free-radical damage. Overall, 1-Methoxyberberium exhibits diverse biological activities and has the potential to be utilized in various health and beauty applications.
Check Digit Verification of cas no
The CAS Registry Mumber 29133-52-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,1,3 and 3 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 29133-52:
(7*2)+(6*9)+(5*1)+(4*3)+(3*3)+(2*5)+(1*2)=106
106 % 10 = 6
So 29133-52-6 is a valid CAS Registry Number.
InChI:InChI=1/C21H20NO5.ClH/c1-23-16-5-4-12-8-15-18-13(6-7-22(15)10-14(12)19(16)24-2)9-17-20(21(18)25-3)27-11-26-17;/h4-5,8-10H,6-7,11H2,1-3H3;1H/q+1;/p-1