29241-64-3 Usage
Uses
Used in Pharmaceutical Industry:
5,6-DIBROMOPYRIDINE-3-CARBOXYLIC ACID is used as a key intermediate in the synthesis of various pharmaceutical compounds for its ability to contribute to the development of new drugs. Its unique structure allows for the creation of molecules with specific therapeutic properties, making it a valuable asset in drug discovery and design.
Used in Agrochemical Industry:
5,6-DIBROMOPYRIDINE-3-CARBOXYLIC ACID is utilized as a building block in the formulation of agrochemicals, specifically pesticides. Its incorporation into these products enhances their effectiveness in controlling pests and diseases, thereby contributing to improved crop yields and agricultural productivity.
Used in Research and Development:
5,6-DIBROMOPYRIDINE-3-CARBOXYLIC ACID serves as a crucial component in scientific research, particularly in the exploration of its biological activities. Its potential applications in creating new compounds with specific biological functions make it an essential tool for researchers working in both the pharmaceutical and agricultural industries.
Check Digit Verification of cas no
The CAS Registry Mumber 29241-64-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,2,4 and 1 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 29241-64:
(7*2)+(6*9)+(5*2)+(4*4)+(3*1)+(2*6)+(1*4)=113
113 % 10 = 3
So 29241-64-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H3Br2NO2/c7-4-1-3(6(10)11)2-9-5(4)8/h1-2H,(H,10,11)
