292621-50-2 Usage
Uses
Used in Pharmaceutical Industry:
2-BROMO-3,4,5,6-TETRAFLUOROBENZYLCHLORIDE is used as a chemical intermediate for the synthesis of various pharmaceuticals. Its unique structure and reactivity make it a valuable component in the development of new drugs and medicinal compounds.
Used in Agrochemical Industry:
In the agrochemical industry, 2-BROMO-3,4,5,6-TETRAFLUOROBENZYLCHLORIDE is used as a precursor in the production of various agrochemicals. Its properties allow for the creation of effective and targeted pest control agents, contributing to improved crop protection and yield.
Used in Polymer Production:
2-BROMO-3,4,5,6-TETRAFLUOROBENZYLCHLORIDE is used as a monomer or a building block in the synthesis of various polymers. Its presence in the polymer chain can impart specific properties, such as increased stability, flame resistance, or chemical resistance, making the resulting polymers suitable for a wide range of applications.
Used in Specialty Chemicals:
2-BROMO-3,4,5,6-TETRAFLUOROBENZYLCHLORIDE is also utilized in the production of specialty chemicals, which are high-value chemicals used in niche applications. The unique properties of 2-BROMO-3,4,5,6-TETRAFLUOROBENZYLCHLORIDE make it an essential component in the formulation of these specialty chemicals, which can be used in various industries such as coatings, adhesives, and advanced materials.
Check Digit Verification of cas no
The CAS Registry Mumber 292621-50-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,9,2,6,2 and 1 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 292621-50:
(8*2)+(7*9)+(6*2)+(5*6)+(4*2)+(3*1)+(2*5)+(1*0)=142
142 % 10 = 2
So 292621-50-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H2BrClF4/c8-3-2(1-9)4(10)6(12)7(13)5(3)11/h1H2
